C7H12Cl2N4O — CID 138041016
2-chloro-N-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]acetamide;hydrochloride (PubChem CID 138041016) has the molecular formula C7H12Cl2N4O and a molecular weight of 239.11 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-chloro-N-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 138041016 |
| Molecular Formula | C7H12Cl2N4O |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-chloro-N-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]acetamide;hydrochloride |
| SMILES | CN(Cc1ncnn1C)C(=O)CCl.Cl |
| InChI | InChI=1S/C7H11ClN4O.ClH/c1-11(7(13)3-8)4-6-9-5-10-12(6)2;/h5H,3-4H2,1-2H3;1H |
| InChIKey | LGSRQTHEHSTOOV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|