About 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol
2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol (PubChem CID 138041041) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol |
| PubChem CID | 138041041 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol |
| SMILES | Cc1cc(C)nc(NCC(C)(O)C2CC2)n1 |
| InChI | InChI=1S/C12H19N3O/c1-8-6-9(2)15-11(14-8)13-7-12(3,16)10-4-5-10/h6,10,16H,4-5,7H2,1-3H3,(H,13,14,15) |
| InChIKey | OBFISNFMRWFTRR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol?
The IUPAC name of 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol (CID 138041041) is 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol.
What is the SMILES notation for 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol?
The canonical SMILES for 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol is Cc1cc(C)nc(NCC(C)(O)C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol?
The InChIKey is OBFISNFMRWFTRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-8-6-9(2)15-11(14-8)13-7-12(3,16)10-4-5-10/h6,10,16H,4-5,7H2,1-3H3,(H,13,14,15).
What are the key properties of 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol?
2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol has a molecular weight of 221.30 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1-[(4,6-dimethylpyrimidin-2-yl)amino]propan-2-ol is sourced from PubChem (CID 138041041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).