C16H21N3O5 — CID 138041983
methyl 3-[[2-(3-carbamoyl-3-hydroxypiperidin-1-yl)acetyl]amino]benzoate (PubChem CID 138041983) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 3-[[2-(3-carbamoyl-3-hydroxypiperidin-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(3-carbamoyl-3-hydroxypiperidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 138041983 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 3-[[2-(3-carbamoyl-3-hydroxypiperidin-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN2CCCC(O)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C16H21N3O5/c1-24-14(21)11-4-2-5-12(8-11)18-13(20)9-19-7-3-6-16(23,10-19)15(17)22/h2,4-5,8,23H,3,6-7,9-10H2,1H3,(H2,17,22)(H,18,20) |
| InChIKey | UXGKJRTYMLVPGC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |