C16H28N6O2 — CID 138042286
2-[4-[(1-tert-butylpyrazol-4-yl)carbamoylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 138042286) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[4-[(1-tert-butylpyrazol-4-yl)carbamoylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(1-tert-butylpyrazol-4-yl)carbamoylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 138042286 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-[4-[(1-tert-butylpyrazol-4-yl)carbamoylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)Nc2cnn(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C16H28N6O2/c1-16(2,3)22-10-13(9-18-22)20-15(24)19-12-5-7-21(8-6-12)11-14(23)17-4/h9-10,12H,5-8,11H2,1-4H3,(H,17,23)(H2,19,20,24) |
| InChIKey | OLZCNLXPJMWNBP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |