C17H20N6O2 — CID 138042396
3-amino-5-[3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-nitrobenzonitrile (PubChem CID 138042396) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-amino-5-[3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-nitrobenzonitrile.
| Compound Name | 3-amino-5-[3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 138042396 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-amino-5-[3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-nitrobenzonitrile |
| SMILES | CCc1nccn1C1CCCN(c2cc(N)c([N+](=O)[O-])c(C#N)c2)C1 |
| InChI | InChI=1S/C17H20N6O2/c1-2-16-20-5-7-22(16)13-4-3-6-21(11-13)14-8-12(10-18)17(23(24)25)15(19)9-14/h5,7-9,13H,2-4,6,11,19H2,1H3 |
| InChIKey | DXGJVEXGSOINRY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|