C16H19N5O3 — CID 138043019
4-(3-hydroxyphenyl)-N-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 138043019) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-N-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | 4-(3-hydroxyphenyl)-N-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 138043019 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(3-hydroxyphenyl)-N-(6-methoxypyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN(c3cccc(O)c3)CC2)ncn1 |
| InChI | InChI=1S/C16H19N5O3/c1-24-15-10-14(17-11-18-15)19-16(23)21-7-5-20(6-8-21)12-3-2-4-13(22)9-12/h2-4,9-11,22H,5-8H2,1H3,(H,17,18,19,23) |
| InChIKey | OESUFSPLGSPXJM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |