C17H23N3O — CID 138043202
N-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]cyclohexanamine (PubChem CID 138043202) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]cyclohexanamine.
| Compound Name | N-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 138043202 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[1-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]cyclohexanamine |
| SMILES | CC(NC1CCCCC1)c1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H23N3O/c1-13(18-15-10-6-3-7-11-15)17-19-16(21-20-17)12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15,18H,3,6-7,10-12H2,1H3 |
| InChIKey | ORUKUHWEGZTXJE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |