C17H13N3O5 — CID 138043271
5-[[4-(6-methylpyridazin-3-yl)oxyphenyl]carbamoyl]furan-3-carboxylic acid (PubChem CID 138043271) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 5-[[4-(6-methylpyridazin-3-yl)oxyphenyl]carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[[4-(6-methylpyridazin-3-yl)oxyphenyl]carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 138043271 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 5-[[4-(6-methylpyridazin-3-yl)oxyphenyl]carbamoyl]furan-3-carboxylic acid |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3cc(C(=O)O)co3)cc2)nn1 |
| InChI | InChI=1S/C17H13N3O5/c1-10-2-7-15(20-19-10)25-13-5-3-12(4-6-13)18-16(21)14-8-11(9-24-14)17(22)23/h2-9H,1H3,(H,18,21)(H,22,23) |
| InChIKey | YQMOCRSXLIKVIQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |