C12H10F3N3O2 — CID 138043813
[3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 3,3,3-trifluoropropanoate (PubChem CID 138043813) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 3,3,3-trifluoropropanoate.
| Compound Name | [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 138043813 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [3-(1-methyl-1,2,4-triazol-3-yl)phenyl] 3,3,3-trifluoropropanoate |
| SMILES | Cn1cnc(-c2cccc(OC(=O)CC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H10F3N3O2/c1-18-7-16-11(17-18)8-3-2-4-9(5-8)20-10(19)6-12(13,14)15/h2-5,7H,6H2,1H3 |
| InChIKey | KVAZAVPYINNYPG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|