C20H30N4O3 — CID 138044085
N-[(2-ethoxyphenyl)methyl]-4-(1-methylpyrrolidine-2-carbonyl)piperazine-1-carboxamide (PubChem CID 138044085) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-4-(1-methylpyrrolidine-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-4-(1-methylpyrrolidine-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 138044085 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-4-(1-methylpyrrolidine-2-carbonyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1CNC(=O)N1CCN(C(=O)C2CCCN2C)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-3-27-18-9-5-4-7-16(18)15-21-20(26)24-13-11-23(12-14-24)19(25)17-8-6-10-22(17)2/h4-5,7,9,17H,3,6,8,10-15H2,1-2H3,(H,21,26) |
| InChIKey | LFGSQQWVIYDZHF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |