C10H14ClNO — CID 138044573
5-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride (PubChem CID 138044573) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride.
| Compound Name | 5-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride |
|---|---|
| PubChem CID | 138044573 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride |
| SMILES | Cc1ccc(O)c2c1CCCN2.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-7-4-5-9(12)10-8(7)3-2-6-11-10;/h4-5,11-12H,2-3,6H2,1H3;1H |
| InChIKey | ODZJVDQAOIXFQB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|