About 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline
8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline (PubChem CID 138045462) has the molecular formula C15H16ClFN2O2
and a molecular weight of 310.76 g/mol. Its IUPAC name is 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline.
Molecular Properties
| Compound Name | 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline |
| PubChem CID | 138045462 |
| Molecular Formula | C15H16ClFN2O2 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline |
| SMILES | CO[C@H]1CN(c2ccc3cc(F)cc(Cl)c3n2)C[C@H]1OC |
| InChI | InChI=1S/C15H16ClFN2O2/c1-20-12-7-19(8-13(12)21-2)14-4-3-9-5-10(17)6-11(16)15(9)18-14/h3-6,12-13H,7-8H2,1-2H3/t12-,13+ |
| InChIKey | VDQJNCZJTOMDPC-BETUJISGSA-N |
| XLogP | 2.88 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline?
The IUPAC name of 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline (CID 138045462) is 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline.
What is the SMILES notation for 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline?
The canonical SMILES for 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline is CO[C@H]1CN(c2ccc3cc(F)cc(Cl)c3n2)C[C@H]1OC.
What is the InChIKey of 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline?
The InChIKey is VDQJNCZJTOMDPC-BETUJISGSA-N. The full InChI is InChI=1S/C15H16ClFN2O2/c1-20-12-7-19(8-13(12)21-2)14-4-3-9-5-10(17)6-11(16)15(9)18-14/h3-6,12-13H,7-8H2,1-2H3/t12-,13+.
What are the key properties of 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline?
8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline has a molecular weight of 310.76 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-6-fluoroquinoline is sourced from PubChem (CID 138045462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).