About 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid
3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 138045770) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid |
| PubChem CID | 138045770 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)CC1CCCN1Cc1ccoc1C(=O)O |
| InChI | InChI=1S/C15H23NO3/c1-15(2,3)9-12-5-4-7-16(12)10-11-6-8-19-13(11)14(17)18/h6,8,12H,4-5,7,9-10H2,1-3H3,(H,17,18) |
| InChIKey | LNFLJFVTSZLOGA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid?
The IUPAC name of 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid (CID 138045770) is 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid.
What is the SMILES notation for 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid?
The canonical SMILES for 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid is CC(C)(C)CC1CCCN1Cc1ccoc1C(=O)O.
What is the InChIKey of 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid?
The InChIKey is LNFLJFVTSZLOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-15(2,3)9-12-5-4-7-16(12)10-11-6-8-19-13(11)14(17)18/h6,8,12H,4-5,7,9-10H2,1-3H3,(H,17,18).
What are the key properties of 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid?
3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid has a molecular weight of 265.35 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,2-dimethylpropyl)pyrrolidin-1-yl]methyl]furan-2-carboxylic acid is sourced from PubChem (CID 138045770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).