About (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol
(3-piperidin-4-yl-1,2-oxazol-5-yl)methanol (PubChem CID 138046457) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol |
| PubChem CID | 138046457 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol |
| SMILES | OCc1cc(C2CCNCC2)no1 |
| InChI | InChI=1S/C9H14N2O2/c12-6-8-5-9(11-13-8)7-1-3-10-4-2-7/h5,7,10,12H,1-4,6H2 |
| InChIKey | FICFSHKTPFXGTP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol?
The IUPAC name of (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol (CID 138046457) is (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol.
What is the SMILES notation for (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol?
The canonical SMILES for (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol is OCc1cc(C2CCNCC2)no1.
What is the InChIKey of (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol?
The InChIKey is FICFSHKTPFXGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c12-6-8-5-9(11-13-8)7-1-3-10-4-2-7/h5,7,10,12H,1-4,6H2.
What are the key properties of (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol?
(3-piperidin-4-yl-1,2-oxazol-5-yl)methanol has a molecular weight of 182.22 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-piperidin-4-yl-1,2-oxazol-5-yl)methanol is sourced from PubChem (CID 138046457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).