C10H12ClN3O3S — CID 138046747
N-(4-chloro-1H-indazol-5-yl)-2-methoxyethanesulfonamide (PubChem CID 138046747) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is N-(4-chloro-1H-indazol-5-yl)-2-methoxyethanesulfonamide.
| Compound Name | N-(4-chloro-1H-indazol-5-yl)-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 138046747 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(4-chloro-1H-indazol-5-yl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1ccc2[nH]ncc2c1Cl |
| InChI | InChI=1S/C10H12ClN3O3S/c1-17-4-5-18(15,16)14-9-3-2-8-7(10(9)11)6-12-13-8/h2-3,6,14H,4-5H2,1H3,(H,12,13) |
| InChIKey | NZEILCZFBMOELD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |