About 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide
2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide (PubChem CID 138046943) has the molecular formula C13H23F3N2O3S
and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide |
| PubChem CID | 138046943 |
| Molecular Formula | C13H23F3N2O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide |
| SMILES | CCC(CC(F)(F)F)CS(=O)(=O)NC1CCN(C(C)C)C1=O |
| InChI | InChI=1S/C13H23F3N2O3S/c1-4-10(7-13(14,15)16)8-22(20,21)17-11-5-6-18(9(2)3)12(11)19/h9-11,17H,4-8H2,1-3H3 |
| InChIKey | NJTVJDICNZESCV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide?
The IUPAC name of 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide (CID 138046943) is 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide.
What is the SMILES notation for 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide?
The canonical SMILES for 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide is CCC(CC(F)(F)F)CS(=O)(=O)NC1CCN(C(C)C)C1=O.
What is the InChIKey of 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide?
The InChIKey is NJTVJDICNZESCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O3S/c1-4-10(7-13(14,15)16)8-22(20,21)17-11-5-6-18(9(2)3)12(11)19/h9-11,17H,4-8H2,1-3H3.
What are the key properties of 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide?
2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide has a molecular weight of 344.40 g/mol, XLogP of 1.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,4,4-trifluoro-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butane-1-sulfonamide is sourced from PubChem (CID 138046943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).