C15H26N6O — CID 138047066
N-cyclooctyl-4-(2H-tetrazol-5-yl)piperidine-1-carboxamide (PubChem CID 138047066) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-cyclooctyl-4-(2H-tetrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-cyclooctyl-4-(2H-tetrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 138047066 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | N-cyclooctyl-4-(2H-tetrazol-5-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)N1CCC(c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C15H26N6O/c22-15(16-13-6-4-2-1-3-5-7-13)21-10-8-12(9-11-21)14-17-19-20-18-14/h12-13H,1-11H2,(H,16,22)(H,17,18,19,20) |
| InChIKey | CSIGJAXSPYUTHJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |