C11H13N5O4S — CID 138047479
methyl 2-[(2-ethyltriazol-4-yl)sulfonylamino]pyridine-4-carboxylate (PubChem CID 138047479) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is methyl 2-[(2-ethyltriazol-4-yl)sulfonylamino]pyridine-4-carboxylate.
| Compound Name | methyl 2-[(2-ethyltriazol-4-yl)sulfonylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 138047479 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl 2-[(2-ethyltriazol-4-yl)sulfonylamino]pyridine-4-carboxylate |
| SMILES | CCn1ncc(S(=O)(=O)Nc2cc(C(=O)OC)ccn2)n1 |
| InChI | InChI=1S/C11H13N5O4S/c1-3-16-13-7-10(14-16)21(18,19)15-9-6-8(4-5-12-9)11(17)20-2/h4-7H,3H2,1-2H3,(H,12,15) |
| InChIKey | AXEFPGPUEKVMNL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |