About 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione
3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 138047633) has the molecular formula C14H15F2N3O5
and a molecular weight of 343.29 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione |
| PubChem CID | 138047633 |
| Molecular Formula | C14H15F2N3O5 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccc([N+](=O)[O-])cc2)C(=O)N1CCOCC(F)F |
| InChI | InChI=1S/C14H15F2N3O5/c15-12(16)8-24-6-5-18-13(20)11(17-14(18)21)7-9-1-3-10(4-2-9)19(22)23/h1-4,11-12H,5-8H2,(H,17,21) |
| InChIKey | RZRBKRLBOHDJLV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione?
The IUPAC name of 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione (CID 138047633) is 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione.
What is the SMILES notation for 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione?
The canonical SMILES for 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione is O=C1NC(Cc2ccc([N+](=O)[O-])cc2)C(=O)N1CCOCC(F)F.
What is the InChIKey of 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione?
The InChIKey is RZRBKRLBOHDJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3O5/c15-12(16)8-24-6-5-18-13(20)11(17-14(18)21)7-9-1-3-10(4-2-9)19(22)23/h1-4,11-12H,5-8H2,(H,17,21).
What are the key properties of 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione?
3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione has a molecular weight of 343.29 g/mol, XLogP of 1.34, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione is sourced from PubChem (CID 138047633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).