C12H17N3O2S3 — CID 138047660
2-[[5-[[(3aS,6aS)-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 138047660) has the molecular formula C12H17N3O2S3 and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-[[5-[[(3aS,6aS)-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[[(3aS,6aS)-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 138047660 |
| Molecular Formula | C12H17N3O2S3 |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-[[5-[[(3aS,6aS)-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nnc(SC[C@]23CCC[C@H]2CCO3)s1 |
| InChI | InChI=1S/C12H17N3O2S3/c13-9(16)6-18-10-14-15-11(20-10)19-7-12-4-1-2-8(12)3-5-17-12/h8H,1-7H2,(H2,13,16)/t8-,12+/m0/s1 |
| InChIKey | ADQVTQONISSWIZ-QPUJVOFHSA-N |
| XLogP | 2.17 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |