C13H22N4 — CID 138047696
(3aR,6aS)-N-[(1-ethylpyrazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine (PubChem CID 138047696) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is (3aR,6aS)-N-[(1-ethylpyrazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine.
| Compound Name | (3aR,6aS)-N-[(1-ethylpyrazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine |
|---|---|
| PubChem CID | 138047696 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (3aR,6aS)-N-[(1-ethylpyrazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine |
| SMILES | CCn1ccc(CN[C@]23CCC[C@H]2CNC3)n1 |
| InChI | InChI=1S/C13H22N4/c1-2-17-7-5-12(16-17)9-15-13-6-3-4-11(13)8-14-10-13/h5,7,11,14-15H,2-4,6,8-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | BXFLJOOPQBVJSJ-AAEUAGOBSA-N |
| XLogP | 1.13 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |