About N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide
N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide (PubChem CID 138047887) has the molecular formula C15H25N3O4S
and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide |
| PubChem CID | 138047887 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide |
| SMILES | Cc1noc(CCCNS(=O)(=O)CC2CC3(CCCC3)CO2)n1 |
| InChI | InChI=1S/C15H25N3O4S/c1-12-17-14(22-18-12)5-4-8-16-23(19,20)10-13-9-15(11-21-13)6-2-3-7-15/h13,16H,2-11H2,1H3 |
| InChIKey | YDOBKTJWSUOKAG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide?
The IUPAC name of N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide (CID 138047887) is N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide.
What is the SMILES notation for N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide?
The canonical SMILES for N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide is Cc1noc(CCCNS(=O)(=O)CC2CC3(CCCC3)CO2)n1.
What is the InChIKey of N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide?
The InChIKey is YDOBKTJWSUOKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O4S/c1-12-17-14(22-18-12)5-4-8-16-23(19,20)10-13-9-15(11-21-13)6-2-3-7-15/h13,16H,2-11H2,1H3.
What are the key properties of N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide?
N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide has a molecular weight of 343.45 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-1-(2-oxaspiro[4.4]nonan-3-yl)methanesulfonamide is sourced from PubChem (CID 138047887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).