C17H21N3O2 — CID 138048170
N-(1-benzylpyrazol-4-yl)-2-[(1S,2R)-2-hydroxycyclopentyl]acetamide (PubChem CID 138048170) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-2-[(1S,2R)-2-hydroxycyclopentyl]acetamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-2-[(1S,2R)-2-hydroxycyclopentyl]acetamide |
|---|---|
| PubChem CID | 138048170 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-2-[(1S,2R)-2-hydroxycyclopentyl]acetamide |
| SMILES | O=C(C[C@@H]1CCC[C@H]1O)Nc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H21N3O2/c21-16-8-4-7-14(16)9-17(22)19-15-10-18-20(12-15)11-13-5-2-1-3-6-13/h1-3,5-6,10,12,14,16,21H,4,7-9,11H2,(H,19,22)/t14-,16+/m0/s1 |
| InChIKey | NNMPQGUQQSYGFC-GOEBONIOSA-N |
| XLogP | 2.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |