C21H26N4O4 — CID 138048584
trans-(1S,2S)-2-methyl-N-[[(1R,5S)-8-(2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 138048584) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is trans-(1S,2S)-2-methyl-N-[[(1R,5S)-8-(2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]methyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-methyl-N-[[(1R,5S)-8-(2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138048584 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | trans-(1S,2S)-2-methyl-N-[[(1R,5S)-8-(2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@@H]1C(=O)NCC1C[C@H]2CC[C@@H](C1)N2C(=O)c1cnc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C21H26N4O4/c1-11-4-16(11)19(27)22-8-12-5-14-2-3-15(6-12)25(14)21(28)13-7-17-20(23-9-13)29-10-18(26)24-17/h7,9,11-12,14-16H,2-6,8,10H2,1H3,(H,22,27)(H,24,26)/t11-,12?,14-,15+,16-/m0/s1 |
| InChIKey | ASRKBVSFWGREHE-GJIXHBHRSA-N |
| XLogP | 1.57 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |