C17H30N2O5S — CID 138048746
N-[(3S)-3-[(1-methylsulfonylcyclopentanecarbonyl)amino]butyl]oxane-4-carboxamide (PubChem CID 138048746) has the molecular formula C17H30N2O5S and a molecular weight of 374.50 g/mol. Its IUPAC name is N-[(3S)-3-[(1-methylsulfonylcyclopentanecarbonyl)amino]butyl]oxane-4-carboxamide.
| Compound Name | N-[(3S)-3-[(1-methylsulfonylcyclopentanecarbonyl)amino]butyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 138048746 |
| Molecular Formula | C17H30N2O5S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[(3S)-3-[(1-methylsulfonylcyclopentanecarbonyl)amino]butyl]oxane-4-carboxamide |
| SMILES | C[C@@H](CCNC(=O)C1CCOCC1)NC(=O)C1(S(C)(=O)=O)CCCC1 |
| InChI | InChI=1S/C17H30N2O5S/c1-13(5-10-18-15(20)14-6-11-24-12-7-14)19-16(21)17(25(2,22)23)8-3-4-9-17/h13-14H,3-12H2,1-2H3,(H,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | WCFXBZDWJNSXGD-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |