About 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide
1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide (PubChem CID 138049346) has the molecular formula C14H20N2O4S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide.
Molecular Properties
| Compound Name | 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide |
| PubChem CID | 138049346 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide |
| SMILES | C=CCCCCS(=O)(=O)N1CCc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H20N2O4S2/c1-2-3-4-5-10-21(17,18)16-9-8-12-6-7-13(11-14(12)16)22(15,19)20/h2,6-7,11H,1,3-5,8-10H2,(H2,15,19,20) |
| InChIKey | NKUHUKWHMLQCOB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide?
The IUPAC name of 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide (CID 138049346) is 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide.
What is the SMILES notation for 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide?
The canonical SMILES for 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide is C=CCCCCS(=O)(=O)N1CCc2ccc(S(N)(=O)=O)cc21.
What is the InChIKey of 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide?
The InChIKey is NKUHUKWHMLQCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4S2/c1-2-3-4-5-10-21(17,18)16-9-8-12-6-7-13(11-14(12)16)22(15,19)20/h2,6-7,11H,1,3-5,8-10H2,(H2,15,19,20).
What are the key properties of 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide?
1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide has a molecular weight of 344.46 g/mol, XLogP of 1.38, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-5-enylsulfonyl-2,3-dihydroindole-6-sulfonamide is sourced from PubChem (CID 138049346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).