About N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine
N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 138049956) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 138049956 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(C)C1CN=C(NCc2ccccc2)N1 |
| InChI | InChI=1S/C13H19N3/c1-10(2)12-9-15-13(16-12)14-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H2,14,15,16) |
| InChIKey | LVQSAGHAZLJPFF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine (CID 138049956) is N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine is CC(C)C1CN=C(NCc2ccccc2)N1.
What is the InChIKey of N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is LVQSAGHAZLJPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-10(2)12-9-15-13(16-12)14-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H2,14,15,16).
What are the key properties of N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 217.32 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 138049956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).