C10H13F3N4O2S2 — CID 138050208
(2S,4S)-4-methoxy-1-methyl-N-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide (PubChem CID 138050208) has the molecular formula C10H13F3N4O2S2 and a molecular weight of 342.37 g/mol. Its IUPAC name is (2S,4S)-4-methoxy-1-methyl-N-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-methoxy-1-methyl-N-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 138050208 |
| Molecular Formula | C10H13F3N4O2S2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (2S,4S)-4-methoxy-1-methyl-N-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1C[C@@H](C(=O)Nc2nnc(SC(F)(F)F)s2)N(C)C1 |
| InChI | InChI=1S/C10H13F3N4O2S2/c1-17-4-5(19-2)3-6(17)7(18)14-8-15-16-9(20-8)21-10(11,12)13/h5-6H,3-4H2,1-2H3,(H,14,15,18)/t5-,6-/m0/s1 |
| InChIKey | BYKRYKJALJYBOK-WDSKDSINSA-N |
| XLogP | 1.81 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|