About 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine
5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine (PubChem CID 138050714) has the molecular formula C10H11ClN4OS
and a molecular weight of 270.75 g/mol. Its IUPAC name is 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine |
| PubChem CID | 138050714 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine |
| SMILES | COc1nscc1CN(C)c1ncncc1Cl |
| InChI | InChI=1S/C10H11ClN4OS/c1-15(9-8(11)3-12-6-13-9)4-7-5-17-14-10(7)16-2/h3,5-6H,4H2,1-2H3 |
| InChIKey | LRROEBKHYOTWON-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine?
The IUPAC name of 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine (CID 138050714) is 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine.
What is the SMILES notation for 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine?
The canonical SMILES for 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine is COc1nscc1CN(C)c1ncncc1Cl.
What is the InChIKey of 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine?
The InChIKey is LRROEBKHYOTWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN4OS/c1-15(9-8(11)3-12-6-13-9)4-7-5-17-14-10(7)16-2/h3,5-6H,4H2,1-2H3.
What are the key properties of 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine?
5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine has a molecular weight of 270.75 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(3-methoxy-1,2-thiazol-4-yl)methyl]-N-methylpyrimidin-4-amine is sourced from PubChem (CID 138050714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).