C19H22N4O2 — CID 138051875
(3aR,6aR)-3a-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-phenyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 138051875) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3aR,6aR)-3a-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-phenyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aR)-3a-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-phenyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 138051875 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3aR,6aR)-3a-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-phenyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1C[C@@H]2CCC[C@]2(c2nnc(C3CC3)o2)C1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(20-15-6-2-1-3-7-15)23-11-14-5-4-10-19(14,12-23)17-22-21-16(25-17)13-8-9-13/h1-3,6-7,13-14H,4-5,8-12H2,(H,20,24)/t14-,19-/m0/s1 |
| InChIKey | ZVYMSGXYPIJBSH-LIRRHRJNSA-N |
| XLogP | 3.53 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |