C12H14N2O4 — CID 138052243
5-(furan-2-yl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-1,3,4-oxadiazol-2-one (PubChem CID 138052243) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(furan-2-yl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 138052243 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-(furan-2-yl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-1,3,4-oxadiazol-2-one |
| SMILES | COC/C(C)=C/Cn1nc(-c2ccco2)oc1=O |
| InChI | InChI=1S/C12H14N2O4/c1-9(8-16-2)5-6-14-12(15)18-11(13-14)10-4-3-7-17-10/h3-5,7H,6,8H2,1-2H3/b9-5+ |
| InChIKey | BHOUIBRPUQQQGV-WEVVVXLNSA-N |
| XLogP | 1.69 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|