About (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol
(1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 138052858) has the molecular formula C17H18BrNO2
and a molecular weight of 348.24 g/mol. Its IUPAC name is (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 138052858 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@@H](CN[C@@H]1c2ccccc2C[C@@H]1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO2/c18-13-7-5-11(6-8-13)16(21)10-19-17-14-4-2-1-3-12(14)9-15(17)20/h1-8,15-17,19-21H,9-10H2/t15-,16-,17+/m0/s1 |
| InChIKey | BPLUTJGWCQCWEZ-YESZJQIVSA-N |
| XLogP | 2.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol (CID 138052858) is (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol is O[C@@H](CN[C@@H]1c2ccccc2C[C@@H]1O)c1ccc(Br)cc1.
What is the InChIKey of (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol?
The InChIKey is BPLUTJGWCQCWEZ-YESZJQIVSA-N. The full InChI is InChI=1S/C17H18BrNO2/c18-13-7-5-11(6-8-13)16(21)10-19-17-14-4-2-1-3-12(14)9-15(17)20/h1-8,15-17,19-21H,9-10H2/t15-,16-,17+/m0/s1.
What are the key properties of (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol?
(1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol has a molecular weight of 348.24 g/mol, XLogP of 2.73, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-[[(2R)-2-(4-bromophenyl)-2-hydroxyethyl]amino]-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 138052858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).