C15H23N5 — CID 138053520
7-[(3R,5S)-3,5-dimethylazepan-1-yl]-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 138053520) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 7-[(3R,5S)-3,5-dimethylazepan-1-yl]-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-[(3R,5S)-3,5-dimethylazepan-1-yl]-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 138053520 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 7-[(3R,5S)-3,5-dimethylazepan-1-yl]-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2ncnn2c(N2CC[C@@H](C)C[C@@H](C)C2)c1C |
| InChI | InChI=1S/C15H23N5/c1-10-5-6-19(8-11(2)7-10)14-12(3)13(4)18-15-16-9-17-20(14)15/h9-11H,5-8H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | XDRXMPGGEITYMN-GHMZBOCLSA-N |
| XLogP | 2.61 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |