About 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine
4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine (PubChem CID 138054075) has the molecular formula C15H23N7O2
and a molecular weight of 333.40 g/mol. Its IUPAC name is 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine |
| PubChem CID | 138054075 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine |
| SMILES | c1cc(Cn2nnnc2N2CCC(CN3CCOCC3)CC2)no1 |
| InChI | InChI=1S/C15H23N7O2/c1-4-21(5-2-13(1)11-20-6-9-23-10-7-20)15-16-18-19-22(15)12-14-3-8-24-17-14/h3,8,13H,1-2,4-7,9-12H2 |
| InChIKey | KGWFQJRIGZSVJK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine?
The IUPAC name of 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine (CID 138054075) is 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine.
What is the SMILES notation for 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine?
The canonical SMILES for 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine is c1cc(Cn2nnnc2N2CCC(CN3CCOCC3)CC2)no1.
What is the InChIKey of 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine?
The InChIKey is KGWFQJRIGZSVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N7O2/c1-4-21(5-2-13(1)11-20-6-9-23-10-7-20)15-16-18-19-22(15)12-14-3-8-24-17-14/h3,8,13H,1-2,4-7,9-12H2.
What are the key properties of 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine?
4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine has a molecular weight of 333.40 g/mol, XLogP of 0.26, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-[1-(1,2-oxazol-3-ylmethyl)tetrazol-5-yl]piperidin-4-yl]methyl]morpholine is sourced from PubChem (CID 138054075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).