About 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine
1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine (PubChem CID 138054600) has the molecular formula C13H21FN4O
and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine |
| PubChem CID | 138054600 |
| Molecular Formula | C13H21FN4O |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine |
| SMILES | CCCOc1ccnc(N2C[C@@H](F)C[C@H]2CNC)n1 |
| InChI | InChI=1S/C13H21FN4O/c1-3-6-19-12-4-5-16-13(17-12)18-9-10(14)7-11(18)8-15-2/h4-5,10-11,15H,3,6-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | OPQYCWJSMBIULQ-QWRGUYRKSA-N |
| XLogP | 1.40 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine?
The IUPAC name of 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine (CID 138054600) is 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine?
The canonical SMILES for 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine is CCCOc1ccnc(N2C[C@@H](F)C[C@H]2CNC)n1.
What is the InChIKey of 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine?
The InChIKey is OPQYCWJSMBIULQ-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H21FN4O/c1-3-6-19-12-4-5-16-13(17-12)18-9-10(14)7-11(18)8-15-2/h4-5,10-11,15H,3,6-9H2,1-2H3/t10-,11-/m0/s1.
What are the key properties of 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine?
1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine has a molecular weight of 268.34 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S)-4-fluoro-1-(4-propoxypyrimidin-2-yl)pyrrolidin-2-yl]-N-methylmethanamine is sourced from PubChem (CID 138054600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).