About (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone
(4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone (PubChem CID 138054689) has the molecular formula C12H14N6O2
and a molecular weight of 274.28 g/mol. Its IUPAC name is (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone |
| PubChem CID | 138054689 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone |
| SMILES | CC1(C)COCN1C(=O)c1ccc(-c2nn[nH]n2)cn1 |
| InChI | InChI=1S/C12H14N6O2/c1-12(2)6-20-7-18(12)11(19)9-4-3-8(5-13-9)10-14-16-17-15-10/h3-5H,6-7H2,1-2H3,(H,14,15,16,17) |
| InChIKey | ICPGMPNDGXIACW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone?
The IUPAC name of (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone (CID 138054689) is (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone.
What is the SMILES notation for (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone?
The canonical SMILES for (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone is CC1(C)COCN1C(=O)c1ccc(-c2nn[nH]n2)cn1.
What is the InChIKey of (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone?
The InChIKey is ICPGMPNDGXIACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6O2/c1-12(2)6-20-7-18(12)11(19)9-4-3-8(5-13-9)10-14-16-17-15-10/h3-5H,6-7H2,1-2H3,(H,14,15,16,17).
What are the key properties of (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone?
(4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone has a molecular weight of 274.28 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-1,3-oxazolidin-3-yl)-[5-(2H-tetrazol-5-yl)-2-pyridinyl]methanone is sourced from PubChem (CID 138054689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).