C17H22N2O3 — CID 138054702
1-[(3aR,6aS)-2-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(hydroxymethyl)phenyl]ethanone (PubChem CID 138054702) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(hydroxymethyl)phenyl]ethanone.
| Compound Name | 1-[(3aR,6aS)-2-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(hydroxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 138054702 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[(3aR,6aS)-2-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(hydroxymethyl)phenyl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2CN(C(=O)Cc3ccccc3CO)C[C@@H]2C1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(21)18-7-15-9-19(10-16(15)8-18)17(22)6-13-4-2-3-5-14(13)11-20/h2-5,15-16,20H,6-11H2,1H3/t15-,16+ |
| InChIKey | YKYISQLZKKNORK-IYBDPMFKSA-N |
| XLogP | 0.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |