About (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone
(1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone (PubChem CID 138055872) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone.
Molecular Properties
| Compound Name | (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone |
| PubChem CID | 138055872 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone |
| SMILES | CC1(C(=O)N2CCC23CCOCC3)OCCc2ccccc21 |
| InChI | InChI=1S/C18H23NO3/c1-17(15-5-3-2-4-14(15)6-11-22-17)16(20)19-10-7-18(19)8-12-21-13-9-18/h2-5H,6-13H2,1H3 |
| InChIKey | WAKZNTRHVGWHTB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone?
The IUPAC name of (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone (CID 138055872) is (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone.
What is the SMILES notation for (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone?
The canonical SMILES for (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone is CC1(C(=O)N2CCC23CCOCC3)OCCc2ccccc21.
What is the InChIKey of (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone?
The InChIKey is WAKZNTRHVGWHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c1-17(15-5-3-2-4-14(15)6-11-22-17)16(20)19-10-7-18(19)8-12-21-13-9-18/h2-5H,6-13H2,1H3.
What are the key properties of (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone?
(1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone has a molecular weight of 301.39 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,4-dihydroisochromen-1-yl)-(7-oxa-1-azaspiro[3.5]nonan-1-yl)methanone is sourced from PubChem (CID 138055872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).