About 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol
2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol (PubChem CID 138056206) has the molecular formula C18H19NO2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol |
| PubChem CID | 138056206 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol |
| SMILES | Oc1ccc2c(c1)CN(Cc1cccc3c1CCOC3)C2 |
| InChI | InChI=1S/C18H19NO2/c20-17-5-4-13-9-19(11-16(13)8-17)10-14-2-1-3-15-12-21-7-6-18(14)15/h1-5,8,20H,6-7,9-12H2 |
| InChIKey | KQZKJSVGDFWHLO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol?
The IUPAC name of 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol (CID 138056206) is 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol.
What is the SMILES notation for 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol?
The canonical SMILES for 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol is Oc1ccc2c(c1)CN(Cc1cccc3c1CCOC3)C2.
What is the InChIKey of 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol?
The InChIKey is KQZKJSVGDFWHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c20-17-5-4-13-9-19(11-16(13)8-17)10-14-2-1-3-15-12-21-7-6-18(14)15/h1-5,8,20H,6-7,9-12H2.
What are the key properties of 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol?
2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol has a molecular weight of 281.36 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-1H-isochromen-5-ylmethyl)-1,3-dihydroisoindol-5-ol is sourced from PubChem (CID 138056206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).