About N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide
N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide (PubChem CID 138056956) has the molecular formula C16H29N3O3
and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide.
Molecular Properties
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide |
| PubChem CID | 138056956 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide |
| SMILES | C=CC(C)(C)CCNC(=O)C(=O)NCCC(=O)NC(C)CC |
| InChI | InChI=1S/C16H29N3O3/c1-6-12(3)19-13(20)8-10-17-14(21)15(22)18-11-9-16(4,5)7-2/h7,12H,2,6,8-11H2,1,3-5H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | XHUQFDGPTQAFHD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide?
The IUPAC name of N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide (CID 138056956) is N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide.
What is the SMILES notation for N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide?
The canonical SMILES for N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide is C=CC(C)(C)CCNC(=O)C(=O)NCCC(=O)NC(C)CC.
What is the InChIKey of N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide?
The InChIKey is XHUQFDGPTQAFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O3/c1-6-12(3)19-13(20)8-10-17-14(21)15(22)18-11-9-16(4,5)7-2/h7,12H,2,6,8-11H2,1,3-5H3,(H,17,21)(H,18,22)(H,19,20).
What are the key properties of N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide?
N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide has a molecular weight of 311.43 g/mol, XLogP of 1.13, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-(3,3-dimethylpent-4-enyl)oxamide is sourced from PubChem (CID 138056956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).