C22H34N2O2 — CID 138058577
N-[[1-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]-2-ethylbenzamide (PubChem CID 138058577) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[[1-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]-2-ethylbenzamide.
| Compound Name | N-[[1-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]-2-ethylbenzamide |
|---|---|
| PubChem CID | 138058577 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-[[1-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]-2-ethylbenzamide |
| SMILES | CCc1ccccc1C(=O)NCC1(N2CCOC(C)(C)C2)CCCCC1 |
| InChI | InChI=1S/C22H34N2O2/c1-4-18-10-6-7-11-19(18)20(25)23-16-22(12-8-5-9-13-22)24-14-15-26-21(2,3)17-24/h6-7,10-11H,4-5,8-9,12-17H2,1-3H3,(H,23,25) |
| InChIKey | OVWAHLOKLWBVHL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |