About [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone
[2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone (PubChem CID 138058613) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone.
Molecular Properties
| Compound Name | [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone |
| PubChem CID | 138058613 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone |
| SMILES | Cc1ccc(C)c(C2CCCN2C(=O)c2ccnn2CC(C)C)c1 |
| InChI | InChI=1S/C20H27N3O/c1-14(2)13-23-19(9-10-21-23)20(24)22-11-5-6-18(22)17-12-15(3)7-8-16(17)4/h7-10,12,14,18H,5-6,11,13H2,1-4H3 |
| InChIKey | REZPVEXJQJPADX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone?
The IUPAC name of [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone (CID 138058613) is [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone.
What is the SMILES notation for [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone?
The canonical SMILES for [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone is Cc1ccc(C)c(C2CCCN2C(=O)c2ccnn2CC(C)C)c1.
What is the InChIKey of [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone?
The InChIKey is REZPVEXJQJPADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-14(2)13-23-19(9-10-21-23)20(24)22-11-5-6-18(22)17-12-15(3)7-8-16(17)4/h7-10,12,14,18H,5-6,11,13H2,1-4H3.
What are the key properties of [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone?
[2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone has a molecular weight of 325.46 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylphenyl)pyrrolidin-1-yl]-[2-(2-methylpropyl)pyrazol-3-yl]methanone is sourced from PubChem (CID 138058613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).