C16H20OSe — CID 138058998
8-methyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-one (PubChem CID 138058998) has the molecular formula C16H20OSe and a molecular weight of 307.29 g/mol. Its IUPAC name is 8-methyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-one.
| Compound Name | 8-methyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-one |
|---|---|
| PubChem CID | 138058998 |
| Molecular Formula | C16H20OSe |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 8-methyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-one |
| SMILES | CC1CCCC2C(=O)CC(c3ccccc3)[Se]C12 |
| InChI | InChI=1S/C16H20OSe/c1-11-6-5-9-13-14(17)10-15(18-16(11)13)12-7-3-2-4-8-12/h2-4,7-8,11,13,15-16H,5-6,9-10H2,1H3 |
| InChIKey | HAZYGPOPNVUYST-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|