C26H33FN2O5Si — CID 138059438
1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 138059438) has the molecular formula C26H33FN2O5Si and a molecular weight of 500.64 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 138059438 |
| Molecular Formula | C26H33FN2O5Si |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](N2CCC(=O)NC2=O)[C@](C)(F)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33FN2O5Si/c1-25(2,3)35(18-11-7-5-8-12-18,19-13-9-6-10-14-19)33-17-20-22(31)26(4,27)23(34-20)29-16-15-21(30)28-24(29)32/h5-14,20,22-23,31H,15-17H2,1-4H3,(H,28,30,32)/t20-,22-,23-,26-/m1/s1 |
| InChIKey | QYAJCKAAAXSYAR-HUBRGWSESA-N |
| XLogP | 2.32 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|