C15H13N3O2 — CID 1380741
4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 1380741) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 1380741 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | COc1ccc(-c2nnc(-c3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C15H13N3O2/c1-19-13-8-4-11(5-9-13)15-18-17-14(20-15)10-2-6-12(16)7-3-10/h2-9H,16H2,1H3 |
| InChIKey | DDDUQQYRWNLBCN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|