About 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide
1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide (PubChem CID 1380942) has the molecular formula C20H14Br2N2O2
and a molecular weight of 474.15 g/mol. Its IUPAC name is 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide |
| PubChem CID | 1380942 |
| Molecular Formula | C20H14Br2N2O2 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 471.94 |
| IUPAC Name | 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cccc(C(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H14Br2N2O2/c21-15-4-8-17(9-5-15)23-19(25)13-2-1-3-14(12-13)20(26)24-18-10-6-16(22)7-11-18/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | RUTDFUAVXNOLSZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide (CID 1380942) is 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide is O=C(Nc1ccc(Br)cc1)c1cccc(C(=O)Nc2ccc(Br)cc2)c1.
What is the InChIKey of 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide?
The InChIKey is RUTDFUAVXNOLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Br2N2O2/c21-15-4-8-17(9-5-15)23-19(25)13-2-1-3-14(12-13)20(26)24-18-10-6-16(22)7-11-18/h1-12H,(H,23,25)(H,24,26).
What are the key properties of 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide?
1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide has a molecular weight of 474.15 g/mol, XLogP of 5.72, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(4-bromophenyl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 1380942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).