C11H16N2O4 — CID 1380960
5-nitro-N,N-dipropylfuran-2-carboxamide (PubChem CID 1380960) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-nitro-N,N-dipropylfuran-2-carboxamide.
| Compound Name | 5-nitro-N,N-dipropylfuran-2-carboxamide |
|---|---|
| PubChem CID | 1380960 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-nitro-N,N-dipropylfuran-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H16N2O4/c1-3-7-12(8-4-2)11(14)9-5-6-10(17-9)13(15)16/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | SLOORKXUFLBPSL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|