C25H20N2O4 — CID 1381033
3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (PubChem CID 1381033) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1381033 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cc(NC(=O)/C=C/c2ccccc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20N2O4/c28-23(13-11-18-7-3-1-4-8-18)26-21-15-20(25(30)31)16-22(17-21)27-24(29)14-12-19-9-5-2-6-10-19/h1-17H,(H,26,28)(H,27,29)(H,30,31)/b13-11+,14-12+ |
| InChIKey | VQQRONMQSLHUDQ-PHEQNACWSA-N |
| XLogP | 4.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|