3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid

C25H20N2O4 — CID 1381033

IUPAC3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid
SMILESO=C(/C=C/c1ccccc1)Nc1cc(NC(=O)/C=C/c2ccccc2)cc(C(=O)O)c1
InChIInChI=1S/C25H20N2O4/c28-23(13-11-18-7-3-1-4-8-18)26-21-15-20(25(30)31)16-22(17-21)27-24(29)14-12-19-9-5-2-6-10-19/h1-17H,(H,26,28)(H,27,29)(H,30,31)/b13-11+,14-12+
InChIKeyVQQRONMQSLHUDQ-PHEQNACWSA-N
MW412.45 g/mol
LogP4.69
Rot. Bonds7

About 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid

3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (PubChem CID 1381033) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid.

Molecular Properties

Compound Name3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid
PubChem CID1381033
Molecular FormulaC25H20N2O4
Molecular Weight412.45 g/mol
Exact Mass412.14
IUPAC Name3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid
SMILESO=C(/C=C/c1ccccc1)Nc1cc(NC(=O)/C=C/c2ccccc2)cc(C(=O)O)c1
InChIInChI=1S/C25H20N2O4/c28-23(13-11-18-7-3-1-4-8-18)26-21-15-20(25(30)31)16-22(17-21)27-24(29)14-12-19-9-5-2-6-10-19/h1-17H,(H,26,28)(H,27,29)(H,30,31)/b13-11+,14-12+
InChIKeyVQQRONMQSLHUDQ-PHEQNACWSA-N
XLogP4.69
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms31
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500412.45
LogP ≤ 54.69
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid?
The IUPAC name of 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (CID 1381033) is 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid.
What is the SMILES notation for 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid?
The canonical SMILES for 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid is O=C(/C=C/c1ccccc1)Nc1cc(NC(=O)/C=C/c2ccccc2)cc(C(=O)O)c1.
What is the InChIKey of 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid?
The InChIKey is VQQRONMQSLHUDQ-PHEQNACWSA-N. The full InChI is InChI=1S/C25H20N2O4/c28-23(13-11-18-7-3-1-4-8-18)26-21-15-20(25(30)31)16-22(17-21)27-24(29)14-12-19-9-5-2-6-10-19/h1-17H,(H,26,28)(H,27,29)(H,30,31)/b13-11+,14-12+.
What are the key properties of 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid?
3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid has a molecular weight of 412.45 g/mol, XLogP of 4.69, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid is sourced from PubChem (CID 1381033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).