C22H26FN4O5S+ — CID 138105898
[(3S)-3-[[(2S)-3-(4-fluorophenyl)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoyl]amino]-3-[[(2S,3S)-2-hydroxypiperidin-3-yl]methyl]thiiran-2-ylidene]oxidanium (PubChem CID 138105898) has the molecular formula C22H26FN4O5S+ and a molecular weight of 477.54 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-3-(4-fluorophenyl)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoyl]amino]-3-[[(2S,3S)-2-hydroxypiperidin-3-yl]methyl]thiiran-2-ylidene]oxidanium.
| Compound Name | [(3S)-3-[[(2S)-3-(4-fluorophenyl)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoyl]amino]-3-[[(2S,3S)-2-hydroxypiperidin-3-yl]methyl]thiiran-2-ylidene]oxidanium |
|---|---|
| PubChem CID | 138105898 |
| Molecular Formula | C22H26FN4O5S+ |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [(3S)-3-[[(2S)-3-(4-fluorophenyl)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoyl]amino]-3-[[(2S,3S)-2-hydroxypiperidin-3-yl]methyl]thiiran-2-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\S[C@]1(C[C@@H]1CCCN[C@H]1O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C22H25FN4O5S/c1-12-9-17(27-32-12)19(29)25-16(10-13-4-6-15(23)7-5-13)20(30)26-22(21(31)33-22)11-14-3-2-8-24-18(14)28/h4-7,9,14,16,18,24,28H,2-3,8,10-11H2,1H3,(H,25,29)(H,26,30)/p+1/t14-,16-,18-,22-/m0/s1 |
| InChIKey | AJXCKJPJQFWWKB-WSTXMBPASA-O |
| XLogP | 1.23 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|