About 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride
5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride (PubChem CID 138106165) has the molecular formula C10H12ClNO
and a molecular weight of 197.67 g/mol. Its IUPAC name is 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride |
| PubChem CID | 138106165 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride |
| SMILES | Cc1c(N)ccc2c1CCC2=O.Cl |
| InChI | InChI=1S/C10H11NO.ClH/c1-6-7-3-5-10(12)8(7)2-4-9(6)11;/h2,4H,3,5,11H2,1H3;1H |
| InChIKey | XVTWXLMPKYHJTM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride?
The IUPAC name of 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride (CID 138106165) is 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride.
What is the SMILES notation for 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride?
The canonical SMILES for 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride is Cc1c(N)ccc2c1CCC2=O.Cl.
What is the InChIKey of 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride?
The InChIKey is XVTWXLMPKYHJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.ClH/c1-6-7-3-5-10(12)8(7)2-4-9(6)11;/h2,4H,3,5,11H2,1H3;1H.
What are the key properties of 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride?
5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride has a molecular weight of 197.67 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride is sourced from PubChem (CID 138106165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).